7-CHLORO-2-METHYL-4(1H)-QUINOLINONE
Catalog No: FT-0621381
CAS No: 15644-88-9
- Chemical Name: 7-CHLORO-2-METHYL-4(1H)-QUINOLINONE
- Molecular Formula: C10H8ClNO
- Molecular Weight: 193.63
- InChI Key: TWYVITBRDNFBNT-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8ClNO/c1-6-4-10(13)8-3-2-7(11)5-9(8)12-6/h2-5H,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 15644-88-9 |
| Flash_Point: | 141.4ºC |
| Product_Name: | 7-chloro-2-methyl-4(1h)-quinolinone |
| Bolling_Point: | 310.2ºC at 760 mmHg |
| FW: | 193.63000 |
| Melting_Point: | N/A |
| MF: | C10H8ClNO |
| Density: | 1.273g/cm3 |
| Refractive_Index: | 1.587 |
|---|---|
| Vapor_Pressure: | 0.000609mmHg at 25°C |
| MF: | C10H8ClNO |
| Flash_Point: | 141.4ºC |
| LogP: | 2.90220 |
| FW: | 193.63000 |
| Density: | 1.273g/cm3 |
| PSA: | 33.12000 |
| Bolling_Point: | 310.2ºC at 760 mmHg |
| Exact_Mass: | 193.02900 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933499090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)